C21H22F3NO3S — CID 118023315
[(7S,8R)-7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 118023315) has the molecular formula C21H22F3NO3S and a molecular weight of 425.47 g/mol. Its IUPAC name is [(7S,8R)-7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [(7S,8R)-7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118023315 |
| Molecular Formula | C21H22F3NO3S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | [(7S,8R)-7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)[C@@H](Cc1ccccc1)[C@@H](N1CCC1)CC2)C(F)(F)F |
| InChI | InChI=1S/C21H22F3NO3S/c22-21(23,24)29(26,27)28-17-9-7-16-8-10-20(25-11-4-12-25)19(18(16)14-17)13-15-5-2-1-3-6-15/h1-3,5-7,9,14,19-20H,4,8,10-13H2/t19-,20+/m1/s1 |
| InChIKey | OVFYJMUPGHQSRU-UXHICEINSA-N |
| XLogP | 4.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|