C28H30F3N3O4S — CID 57471407
[[7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl]methyl-(1-methylpyrrol-3-yl)sulfonylamino] 2,2,2-trifluoroacetate (PubChem CID 57471407) has the molecular formula C28H30F3N3O4S and a molecular weight of 561.63 g/mol. Its IUPAC name is [[7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl]methyl-(1-methylpyrrol-3-yl)sulfonylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl]methyl-(1-methylpyrrol-3-yl)sulfonylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57471407 |
| Molecular Formula | C28H30F3N3O4S |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | [[7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl]methyl-(1-methylpyrrol-3-yl)sulfonylamino] 2,2,2-trifluoroacetate |
| SMILES | Cn1ccc(S(=O)(=O)N(Cc2ccc3c(c2)C(Cc2ccccc2)C(N2CCC2)CC3)OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C28H30F3N3O4S/c1-32-15-12-23(19-32)39(36,37)34(38-27(35)28(29,30)31)18-21-8-9-22-10-11-26(33-13-5-14-33)25(24(22)17-21)16-20-6-3-2-4-7-20/h2-4,6-9,12,15,17,19,25-26H,5,10-11,13-14,16,18H2,1H3 |
| InChIKey | SQTPZUFCICXHBB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|