C31H32F2N2O4S — CID 158985897
1-[(7S,8R)-7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl]-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfonylmethyl]azetidine (PubChem CID 158985897) has the molecular formula C31H32F2N2O4S and a molecular weight of 566.67 g/mol. Its IUPAC name is 1-[(7S,8R)-7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl]-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfonylmethyl]azetidine.
| Compound Name | 1-[(7S,8R)-7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl]-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfonylmethyl]azetidine |
|---|---|
| PubChem CID | 158985897 |
| Molecular Formula | C31H32F2N2O4S |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | 1-[(7S,8R)-7-(azetidin-1-yl)-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl]-3-[(2,2-difluoro-1,3-benzodioxol-5-yl)sulfonylmethyl]azetidine |
| SMILES | O=S(=O)(CC1CN(c2ccc3c(c2)[C@@H](Cc2ccccc2)[C@@H](N2CCC2)CC3)C1)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C31H32F2N2O4S/c32-31(33)38-29-12-10-25(17-30(29)39-31)40(36,37)20-22-18-35(19-22)24-9-7-23-8-11-28(34-13-4-14-34)27(26(23)16-24)15-21-5-2-1-3-6-21/h1-3,5-7,9-10,12,16-17,22,27-28H,4,8,11,13-15,18-20H2/t27-,28+/m1/s1 |
| InChIKey | JPOIYCGOPJRNRY-IZLXSDGUSA-N |
| XLogP | 5.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |