C28H37NO3S — CID 147213439
1-[4-benzyl-3-(2-cyclopropylethyl)-3,4-dihydro-2H-chromen-6-yl]-3-(propylsulfonylmethyl)azetidine (PubChem CID 147213439) has the molecular formula C28H37NO3S and a molecular weight of 467.68 g/mol. Its IUPAC name is 1-[4-benzyl-3-(2-cyclopropylethyl)-3,4-dihydro-2H-chromen-6-yl]-3-(propylsulfonylmethyl)azetidine.
| Compound Name | 1-[4-benzyl-3-(2-cyclopropylethyl)-3,4-dihydro-2H-chromen-6-yl]-3-(propylsulfonylmethyl)azetidine |
|---|---|
| PubChem CID | 147213439 |
| Molecular Formula | C28H37NO3S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 1-[4-benzyl-3-(2-cyclopropylethyl)-3,4-dihydro-2H-chromen-6-yl]-3-(propylsulfonylmethyl)azetidine |
| SMILES | CCCS(=O)(=O)CC1CN(c2ccc3c(c2)C(Cc2ccccc2)C(CCC2CC2)CO3)C1 |
| InChI | InChI=1S/C28H37NO3S/c1-2-14-33(30,31)20-23-17-29(18-23)25-12-13-28-27(16-25)26(15-22-6-4-3-5-7-22)24(19-32-28)11-10-21-8-9-21/h3-7,12-13,16,21,23-24,26H,2,8-11,14-15,17-20H2,1H3 |
| InChIKey | CFQLKEIXEJHRSG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|