C23H28N2O3 — CID 149079669
ethyl 2-[6-(3-aminoazetidin-1-yl)-4-benzyl-3,4-dihydro-2H-chromen-3-yl]acetate (PubChem CID 149079669) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is ethyl 2-[6-(3-aminoazetidin-1-yl)-4-benzyl-3,4-dihydro-2H-chromen-3-yl]acetate.
| Compound Name | ethyl 2-[6-(3-aminoazetidin-1-yl)-4-benzyl-3,4-dihydro-2H-chromen-3-yl]acetate |
|---|---|
| PubChem CID | 149079669 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | ethyl 2-[6-(3-aminoazetidin-1-yl)-4-benzyl-3,4-dihydro-2H-chromen-3-yl]acetate |
| SMILES | CCOC(=O)CC1COc2ccc(N3CC(N)C3)cc2C1Cc1ccccc1 |
| InChI | InChI=1S/C23H28N2O3/c1-2-27-23(26)11-17-15-28-22-9-8-19(25-13-18(24)14-25)12-21(22)20(17)10-16-6-4-3-5-7-16/h3-9,12,17-18,20H,2,10-11,13-15,24H2,1H3 |
| InChIKey | QQBMMAQJEOYLJS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|