C24H31N3O3S — CID 118023151
N-[1-[(3R,4R)-4-benzyl-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-cyclopropylmethanesulfonamide (PubChem CID 118023151) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is N-[1-[(3R,4R)-4-benzyl-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-cyclopropylmethanesulfonamide.
| Compound Name | N-[1-[(3R,4R)-4-benzyl-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-cyclopropylmethanesulfonamide |
|---|---|
| PubChem CID | 118023151 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[1-[(3R,4R)-4-benzyl-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-cyclopropylmethanesulfonamide |
| SMILES | CN[C@H]1COc2ccc(N3CC(NS(=O)(=O)CC4CC4)C3)cc2[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H31N3O3S/c1-25-23-15-30-24-10-9-20(12-22(24)21(23)11-17-5-3-2-4-6-17)27-13-19(14-27)26-31(28,29)16-18-7-8-18/h2-6,9-10,12,18-19,21,23,25-26H,7-8,11,13-16H2,1H3/t21-,23+/m1/s1 |
| InChIKey | VUJMFMOKCVWOMZ-GGAORHGYSA-N |
| XLogP | 2.51 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|