C24H28FN5O3S — CID 118023844
N-[1-[(3S,4R)-4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-methylpyrazole-4-sulfonamide (PubChem CID 118023844) has the molecular formula C24H28FN5O3S and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[1-[(3S,4R)-4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[1-[(3S,4R)-4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 118023844 |
| Molecular Formula | C24H28FN5O3S |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | N-[1-[(3S,4R)-4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-1-methylpyrazole-4-sulfonamide |
| SMILES | CN[C@@H]1COc2cc(F)c(N3CC(NS(=O)(=O)c4cnn(C)c4)C3)cc2[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H28FN5O3S/c1-26-22-15-33-24-10-21(25)23(9-20(24)19(22)8-16-6-4-3-5-7-16)30-12-17(13-30)28-34(31,32)18-11-27-29(2)14-18/h3-7,9-11,14,17,19,22,26,28H,8,12-13,15H2,1-2H3/t19-,22-/m1/s1 |
| InChIKey | SEBUFIINXAJFCL-DENIHFKCSA-N |
| XLogP | 2.03 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|