C25H30N4O6S — CID 71245390
ethyl N-[4-benzyl-6-[2-[(1-methylpyrazol-4-yl)sulfonylamino]ethoxy]-3,4-dihydro-2H-chromen-3-yl]carbamate (PubChem CID 71245390) has the molecular formula C25H30N4O6S and a molecular weight of 514.60 g/mol. Its IUPAC name is ethyl N-[4-benzyl-6-[2-[(1-methylpyrazol-4-yl)sulfonylamino]ethoxy]-3,4-dihydro-2H-chromen-3-yl]carbamate.
| Compound Name | ethyl N-[4-benzyl-6-[2-[(1-methylpyrazol-4-yl)sulfonylamino]ethoxy]-3,4-dihydro-2H-chromen-3-yl]carbamate |
|---|---|
| PubChem CID | 71245390 |
| Molecular Formula | C25H30N4O6S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | ethyl N-[4-benzyl-6-[2-[(1-methylpyrazol-4-yl)sulfonylamino]ethoxy]-3,4-dihydro-2H-chromen-3-yl]carbamate |
| SMILES | CCOC(=O)NC1COc2ccc(OCCNS(=O)(=O)c3cnn(C)c3)cc2C1Cc1ccccc1 |
| InChI | InChI=1S/C25H30N4O6S/c1-3-33-25(30)28-23-17-35-24-10-9-19(14-22(24)21(23)13-18-7-5-4-6-8-18)34-12-11-27-36(31,32)20-15-26-29(2)16-20/h4-10,14-16,21,23,27H,3,11-13,17H2,1-2H3,(H,28,30) |
| InChIKey | DITBMSUVIPRCIK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|