C27H31F3N4O5S — CID 71245648
N-[[(3S,4S)-4-benzyl-3-(cyclopropylmethylamino)-3,4-dihydro-2H-chromen-6-yl]methyl]-1-methylimidazole-4-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 71245648) has the molecular formula C27H31F3N4O5S and a molecular weight of 580.63 g/mol. Its IUPAC name is N-[[(3S,4S)-4-benzyl-3-(cyclopropylmethylamino)-3,4-dihydro-2H-chromen-6-yl]methyl]-1-methylimidazole-4-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,4S)-4-benzyl-3-(cyclopropylmethylamino)-3,4-dihydro-2H-chromen-6-yl]methyl]-1-methylimidazole-4-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71245648 |
| Molecular Formula | C27H31F3N4O5S |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | N-[[(3S,4S)-4-benzyl-3-(cyclopropylmethylamino)-3,4-dihydro-2H-chromen-6-yl]methyl]-1-methylimidazole-4-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cnc(S(=O)(=O)NCc2ccc3c(c2)[C@H](Cc2ccccc2)[C@H](NCC2CC2)CO3)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H30N4O3S.C2HF3O2/c1-29-15-25(27-17-29)33(30,31)28-14-20-9-10-24-22(12-20)21(11-18-5-3-2-4-6-18)23(16-32-24)26-13-19-7-8-19;3-2(4,5)1(6)7/h2-6,9-10,12,15,17,19,21,23,26,28H,7-8,11,13-14,16H2,1H3;(H,6,7)/t21-,23+;/m0./s1 |
| InChIKey | ZMQFOSJQSXDRHE-ITOBZAKTSA-N |
| XLogP | 3.62 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |