C23H28N4O4S — CID 71245618
N-[2-[[(3S,4S)-4-benzyl-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]oxy]ethyl]-1-methylimidazole-4-sulfonamide (PubChem CID 71245618) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-[2-[[(3S,4S)-4-benzyl-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]oxy]ethyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[2-[[(3S,4S)-4-benzyl-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]oxy]ethyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 71245618 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[2-[[(3S,4S)-4-benzyl-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]oxy]ethyl]-1-methylimidazole-4-sulfonamide |
| SMILES | CN[C@@H]1COc2ccc(OCCNS(=O)(=O)c3cn(C)cn3)cc2[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H28N4O4S/c1-24-21-15-31-22-9-8-18(13-20(22)19(21)12-17-6-4-3-5-7-17)30-11-10-26-32(28,29)23-14-27(2)16-25-23/h3-9,13-14,16,19,21,24,26H,10-12,15H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | ZLWVABJDVYDIMM-PZJWPPBQSA-N |
| XLogP | 2.08 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|