About N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide
N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide (PubChem CID 71249949) has the molecular formula C22H26N4O3S
and a molecular weight of 426.54 g/mol. Its IUPAC name is N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide |
| PubChem CID | 71249949 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCc2ccc3c(c2)C(Cc2ccccc2)C(N)CO3)cn1 |
| InChI | InChI=1S/C22H26N4O3S/c1-2-26-14-18(13-24-26)30(27,28)25-12-17-8-9-22-20(11-17)19(21(23)15-29-22)10-16-6-4-3-5-7-16/h3-9,11,13-14,19,21,25H,2,10,12,15,23H2,1H3 |
| InChIKey | AVHFVZCZYAFWOT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide?
The IUPAC name of N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide (CID 71249949) is N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide.
What is the SMILES notation for N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide?
The canonical SMILES for N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide is CCn1cc(S(=O)(=O)NCc2ccc3c(c2)C(Cc2ccccc2)C(N)CO3)cn1.
What is the InChIKey of N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide?
The InChIKey is AVHFVZCZYAFWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O3S/c1-2-26-14-18(13-24-26)30(27,28)25-12-17-8-9-22-20(11-17)19(21(23)15-29-22)10-16-6-4-3-5-7-16/h3-9,11,13-14,19,21,25H,2,10,12,15,23H2,1H3.
What are the key properties of N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide?
N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide has a molecular weight of 426.54 g/mol, XLogP of 2.43, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)methyl]-1-ethylpyrazole-4-sulfonamide is sourced from PubChem (CID 71249949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).