C26H35N3O3S — CID 118023744
N-[1-[(3S,4S)-4-benzyl-3-(cyclobutylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]propane-1-sulfonamide (PubChem CID 118023744) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is N-[1-[(3S,4S)-4-benzyl-3-(cyclobutylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]propane-1-sulfonamide.
| Compound Name | N-[1-[(3S,4S)-4-benzyl-3-(cyclobutylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 118023744 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-[1-[(3S,4S)-4-benzyl-3-(cyclobutylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC1CN(c2ccc3c(c2)[C@H](Cc2ccccc2)[C@H](NC2CCC2)CO3)C1 |
| InChI | InChI=1S/C26H35N3O3S/c1-2-13-33(30,31)28-21-16-29(17-21)22-11-12-26-24(15-22)23(14-19-7-4-3-5-8-19)25(18-32-26)27-20-9-6-10-20/h3-5,7-8,11-12,15,20-21,23,25,27-28H,2,6,9-10,13-14,16-18H2,1H3/t23-,25+/m0/s1 |
| InChIKey | GFQCJUBVCJONKS-UKILVPOCSA-N |
| XLogP | 3.43 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|