C26H37N3O3S — CID 118023343
N-[1-[(3S,4S)-4-benzyl-3-(diethylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]propane-1-sulfonamide (PubChem CID 118023343) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is N-[1-[(3S,4S)-4-benzyl-3-(diethylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]propane-1-sulfonamide.
| Compound Name | N-[1-[(3S,4S)-4-benzyl-3-(diethylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 118023343 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | N-[1-[(3S,4S)-4-benzyl-3-(diethylamino)-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC1CN(c2ccc3c(c2)[C@H](Cc2ccccc2)[C@H](N(CC)CC)CO3)C1 |
| InChI | InChI=1S/C26H37N3O3S/c1-4-14-33(30,31)27-21-17-29(18-21)22-12-13-26-24(16-22)23(15-20-10-8-7-9-11-20)25(19-32-26)28(5-2)6-3/h7-13,16,21,23,25,27H,4-6,14-15,17-19H2,1-3H3/t23-,25+/m0/s1 |
| InChIKey | KGGVUZIBYRLORP-UKILVPOCSA-N |
| XLogP | 3.63 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|