C22H28N3O3S- — CID 118024993
1-(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)-3-[3-(sulfinatoamino)propyl]azetidine (PubChem CID 118024993) has the molecular formula C22H28N3O3S- and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)-3-[3-(sulfinatoamino)propyl]azetidine.
| Compound Name | 1-(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)-3-[3-(sulfinatoamino)propyl]azetidine |
|---|---|
| PubChem CID | 118024993 |
| Molecular Formula | C22H28N3O3S- |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-(3-amino-4-benzyl-3,4-dihydro-2H-chromen-6-yl)-3-[3-(sulfinatoamino)propyl]azetidine |
| SMILES | NC1COc2ccc(N3CC(CCCNS(=O)[O-])C3)cc2C1Cc1ccccc1 |
| InChI | InChI=1S/C22H29N3O3S/c23-21-15-28-22-9-8-18(25-13-17(14-25)7-4-10-24-29(26)27)12-20(22)19(21)11-16-5-2-1-3-6-16/h1-3,5-6,8-9,12,17,19,21,24H,4,7,10-11,13-15,23H2,(H,26,27)/p-1 |
| InChIKey | UIKIAQGTEFBASI-UHFFFAOYSA-M |
| XLogP | 2.33 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|