C23H30FN3O3S — CID 118024628
1-[4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]-3-[3-(sulfinoamino)propyl]azetidine (PubChem CID 118024628) has the molecular formula C23H30FN3O3S and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-[4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]-3-[3-(sulfinoamino)propyl]azetidine.
| Compound Name | 1-[4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]-3-[3-(sulfinoamino)propyl]azetidine |
|---|---|
| PubChem CID | 118024628 |
| Molecular Formula | C23H30FN3O3S |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1-[4-benzyl-7-fluoro-3-(methylamino)-3,4-dihydro-2H-chromen-6-yl]-3-[3-(sulfinoamino)propyl]azetidine |
| SMILES | CNC1COc2cc(F)c(N3CC(CCCNS(=O)O)C3)cc2C1Cc1ccccc1 |
| InChI | InChI=1S/C23H30FN3O3S/c1-25-21-15-30-23-12-20(24)22(27-13-17(14-27)8-5-9-26-31(28)29)11-19(23)18(21)10-16-6-3-2-4-7-16/h2-4,6-7,11-12,17-18,21,25-26H,5,8-10,13-15H2,1H3,(H,28,29) |
| InChIKey | AZJWNMPUVXCUKL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|