C23H29FN2O3S — CID 90401899
1-benzyl-5-fluoro-2-(methylamino)-6-[2-[1-(sulfinoamino)cyclobutyl]ethoxy]-2,3-dihydro-1H-indene (PubChem CID 90401899) has the molecular formula C23H29FN2O3S and a molecular weight of 432.56 g/mol. Its IUPAC name is 1-benzyl-5-fluoro-2-(methylamino)-6-[2-[1-(sulfinoamino)cyclobutyl]ethoxy]-2,3-dihydro-1H-indene.
| Compound Name | 1-benzyl-5-fluoro-2-(methylamino)-6-[2-[1-(sulfinoamino)cyclobutyl]ethoxy]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 90401899 |
| Molecular Formula | C23H29FN2O3S |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1-benzyl-5-fluoro-2-(methylamino)-6-[2-[1-(sulfinoamino)cyclobutyl]ethoxy]-2,3-dihydro-1H-indene |
| SMILES | CNC1Cc2cc(F)c(OCCC3(NS(=O)O)CCC3)cc2C1Cc1ccccc1 |
| InChI | InChI=1S/C23H29FN2O3S/c1-25-21-14-17-13-20(24)22(29-11-10-23(8-5-9-23)26-30(27)28)15-18(17)19(21)12-16-6-3-2-4-7-16/h2-4,6-7,13,15,19,21,25-26H,5,8-12,14H2,1H3,(H,27,28) |
| InChIKey | ITMWUDURZOBMNW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|