C24H29FN4O3S — CID 123611067
1-[3-[[3-benzyl-6-fluoro-2-(methylaminomethyl)-2,3-dihydro-1H-inden-5-yl]oxy]propyl]pyrazole-4-sulfonamide (PubChem CID 123611067) has the molecular formula C24H29FN4O3S and a molecular weight of 472.59 g/mol. Its IUPAC name is 1-[3-[[3-benzyl-6-fluoro-2-(methylaminomethyl)-2,3-dihydro-1H-inden-5-yl]oxy]propyl]pyrazole-4-sulfonamide.
| Compound Name | 1-[3-[[3-benzyl-6-fluoro-2-(methylaminomethyl)-2,3-dihydro-1H-inden-5-yl]oxy]propyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 123611067 |
| Molecular Formula | C24H29FN4O3S |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 1-[3-[[3-benzyl-6-fluoro-2-(methylaminomethyl)-2,3-dihydro-1H-inden-5-yl]oxy]propyl]pyrazole-4-sulfonamide |
| SMILES | CNCC1Cc2cc(F)c(OCCCn3cc(S(N)(=O)=O)cn3)cc2C1Cc1ccccc1 |
| InChI | InChI=1S/C24H29FN4O3S/c1-27-14-19-11-18-12-23(25)24(13-22(18)21(19)10-17-6-3-2-4-7-17)32-9-5-8-29-16-20(15-28-29)33(26,30)31/h2-4,6-7,12-13,15-16,19,21,27H,5,8-11,14H2,1H3,(H2,26,30,31) |
| InChIKey | ATRQXXZPYWYKTF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|