C25H30FN2O3S- — CID 90401916
1-[1-benzyl-5-fluoro-6-[2-[1-(sulfinatoamino)cyclobutyl]ethoxy]-2,3-dihydro-1H-inden-2-yl]azetidine (PubChem CID 90401916) has the molecular formula C25H30FN2O3S- and a molecular weight of 457.59 g/mol. Its IUPAC name is 1-[1-benzyl-5-fluoro-6-[2-[1-(sulfinatoamino)cyclobutyl]ethoxy]-2,3-dihydro-1H-inden-2-yl]azetidine.
| Compound Name | 1-[1-benzyl-5-fluoro-6-[2-[1-(sulfinatoamino)cyclobutyl]ethoxy]-2,3-dihydro-1H-inden-2-yl]azetidine |
|---|---|
| PubChem CID | 90401916 |
| Molecular Formula | C25H30FN2O3S- |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 1-[1-benzyl-5-fluoro-6-[2-[1-(sulfinatoamino)cyclobutyl]ethoxy]-2,3-dihydro-1H-inden-2-yl]azetidine |
| SMILES | O=S([O-])NC1(CCOc2cc3c(cc2F)CC(N2CCC2)C3Cc2ccccc2)CCC1 |
| InChI | InChI=1S/C25H31FN2O3S/c26-22-15-19-16-23(28-11-5-12-28)21(14-18-6-2-1-3-7-18)20(19)17-24(22)31-13-10-25(8-4-9-25)27-32(29)30/h1-3,6-7,15,17,21,23,27H,4-5,8-14,16H2,(H,29,30)/p-1 |
| InChIKey | JWAKFWFGXHWKNQ-UHFFFAOYSA-M |
| XLogP | 3.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|