About ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate
ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate (PubChem CID 64614174) has the molecular formula C13H17NO3S
and a molecular weight of 267.35 g/mol. Its IUPAC name is ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate.
Analyze ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate?
The IUPAC name of ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate (CID 64614174) is ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate.
What is the SMILES notation for ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate?
The canonical SMILES for ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate is CCOC(=O)CSC1COc2ccccc2C1N.
What is the InChIKey of ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate?
The InChIKey is OBCQGZJEEIFQKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3S/c1-2-16-12(15)8-18-11-7-17-10-6-4-3-5-9(10)13(11)14/h3-6,11,13H,2,7-8,14H2,1H3.
What are the key properties of ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate?
ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate has a molecular weight of 267.35 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]acetate is sourced from PubChem (CID 64614174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).