C13H13N3OS — CID 64648061
3-pyrimidin-2-ylsulfanyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 64648061) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 3-pyrimidin-2-ylsulfanyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 3-pyrimidin-2-ylsulfanyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 64648061 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-pyrimidin-2-ylsulfanyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | NC1c2ccccc2OCC1Sc1ncccn1 |
| InChI | InChI=1S/C13H13N3OS/c14-12-9-4-1-2-5-10(9)17-8-11(12)18-13-15-6-3-7-16-13/h1-7,11-12H,8,14H2 |
| InChIKey | UJQHJQHULZDARE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |