C23H29NO3S — CID 161388678
1-benzyl-7-(3-cyclopropylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 161388678) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-benzyl-7-(3-cyclopropylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 1-benzyl-7-(3-cyclopropylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 161388678 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-benzyl-7-(3-cyclopropylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | NC1CCc2ccc(OCCCS(=O)(=O)C3CC3)cc2C1Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO3S/c24-23-12-8-18-7-9-19(27-13-4-14-28(25,26)20-10-11-20)16-21(18)22(23)15-17-5-2-1-3-6-17/h1-3,5-7,9,16,20,22-23H,4,8,10-15,24H2 |
| InChIKey | VSRLSBABUPSKCC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|