C25H36N2O4S — CID 172817222
1-benzyl-7-[2-(cyclopropylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-amine;propane-1-sulfonic acid (PubChem CID 172817222) has the molecular formula C25H36N2O4S and a molecular weight of 460.64 g/mol. Its IUPAC name is 1-benzyl-7-[2-(cyclopropylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-amine;propane-1-sulfonic acid.
| Compound Name | 1-benzyl-7-[2-(cyclopropylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-amine;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 172817222 |
| Molecular Formula | C25H36N2O4S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 1-benzyl-7-[2-(cyclopropylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-amine;propane-1-sulfonic acid |
| SMILES | CCCS(=O)(=O)O.NC1CCc2ccc(OCCNC3CC3)cc2C1Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O.C3H8O3S/c23-22-11-7-17-6-10-19(25-13-12-24-18-8-9-18)15-20(17)21(22)14-16-4-2-1-3-5-16;1-2-3-7(4,5)6/h1-6,10,15,18,21-22,24H,7-9,11-14,23H2;2-3H2,1H3,(H,4,5,6) |
| InChIKey | SYVQUJYGXAWHDS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|