C25H33Cl2NO3S — CID 158894025
1-[(3,4-dichlorophenyl)methyl]-7-(3-pentylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 158894025) has the molecular formula C25H33Cl2NO3S and a molecular weight of 498.52 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-7-(3-pentylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-7-(3-pentylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 158894025 |
| Molecular Formula | C25H33Cl2NO3S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-7-(3-pentylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCCCS(=O)(=O)CCCOc1ccc2c(c1)C(Cc1ccc(Cl)c(Cl)c1)C(N)CC2 |
| InChI | InChI=1S/C25H33Cl2NO3S/c1-2-3-4-13-32(29,30)14-5-12-31-20-9-7-19-8-11-25(28)22(21(19)17-20)15-18-6-10-23(26)24(27)16-18/h6-7,9-10,16-17,22,25H,2-5,8,11-15,28H2,1H3 |
| InChIKey | JEPKBQKLOARUIL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|