C25H32Cl2N2O5S — CID 59547759
ethyl N-[1-[(3,4-dichlorophenyl)methyl]-7-[2-(propylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate (PubChem CID 59547759) has the molecular formula C25H32Cl2N2O5S and a molecular weight of 543.51 g/mol. Its IUPAC name is ethyl N-[1-[(3,4-dichlorophenyl)methyl]-7-[2-(propylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate.
| Compound Name | ethyl N-[1-[(3,4-dichlorophenyl)methyl]-7-[2-(propylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 59547759 |
| Molecular Formula | C25H32Cl2N2O5S |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | ethyl N-[1-[(3,4-dichlorophenyl)methyl]-7-[2-(propylsulfonylamino)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
| SMILES | CCCS(=O)(=O)NCCOc1ccc2c(c1)C(Cc1ccc(Cl)c(Cl)c1)C(NC(=O)OCC)CC2 |
| InChI | InChI=1S/C25H32Cl2N2O5S/c1-3-13-35(31,32)28-11-12-34-19-8-6-18-7-10-24(29-25(30)33-4-2)21(20(18)16-19)14-17-5-9-22(26)23(27)15-17/h5-6,8-9,15-16,21,24,28H,3-4,7,10-14H2,1-2H3,(H,29,30) |
| InChIKey | UQDCQBWVEAXIFK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|