C23H29Cl2NO3S — CID 158713128
1-[(3,4-dichlorophenyl)methyl]-7-(3-propan-2-ylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 158713128) has the molecular formula C23H29Cl2NO3S and a molecular weight of 470.46 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-7-(3-propan-2-ylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-7-(3-propan-2-ylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 158713128 |
| Molecular Formula | C23H29Cl2NO3S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-7-(3-propan-2-ylsulfonylpropoxy)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CC(C)S(=O)(=O)CCCOc1ccc2c(c1)C(Cc1ccc(Cl)c(Cl)c1)C(N)CC2 |
| InChI | InChI=1S/C23H29Cl2NO3S/c1-15(2)30(27,28)11-3-10-29-18-7-5-17-6-9-23(26)20(19(17)14-18)12-16-4-8-21(24)22(25)13-16/h4-5,7-8,13-15,20,23H,3,6,9-12,26H2,1-2H3 |
| InChIKey | IIYZQHJNSRMTCU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|