C25H31Cl2NO3S — CID 159693298
7-[3-(2-cyclopropylethylsulfonyl)propoxy]-1-[(3,4-dichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 159693298) has the molecular formula C25H31Cl2NO3S and a molecular weight of 496.50 g/mol. Its IUPAC name is 7-[3-(2-cyclopropylethylsulfonyl)propoxy]-1-[(3,4-dichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 7-[3-(2-cyclopropylethylsulfonyl)propoxy]-1-[(3,4-dichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 159693298 |
| Molecular Formula | C25H31Cl2NO3S |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 7-[3-(2-cyclopropylethylsulfonyl)propoxy]-1-[(3,4-dichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | NC1CCc2ccc(OCCCS(=O)(=O)CCC3CC3)cc2C1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H31Cl2NO3S/c26-23-8-4-18(15-24(23)27)14-22-21-16-20(7-5-19(21)6-9-25(22)28)31-11-1-12-32(29,30)13-10-17-2-3-17/h4-5,7-8,15-17,22,25H,1-3,6,9-14,28H2 |
| InChIKey | MWRLQZNRPFNHBI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|