C23H26O3 — CID 69444648
4b-benzyl-7-hydroxy-7-methyl-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxylic acid (PubChem CID 69444648) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 4b-benzyl-7-hydroxy-7-methyl-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxylic acid.
| Compound Name | 4b-benzyl-7-hydroxy-7-methyl-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxylic acid |
|---|---|
| PubChem CID | 69444648 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4b-benzyl-7-hydroxy-7-methyl-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxylic acid |
| SMILES | CC1(O)CCC2(Cc3ccccc3)c3ccc(C(=O)O)cc3CCC2C1 |
| InChI | InChI=1S/C23H26O3/c1-22(26)11-12-23(14-16-5-3-2-4-6-16)19(15-22)9-7-17-13-18(21(24)25)8-10-20(17)23/h2-6,8,10,13,19,26H,7,9,11-12,14-15H2,1H3,(H,24,25) |
| InChIKey | VTWWCQACDBSATN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |