C23H26O3 — CID 163739206
methyl (4bS,8aR)-4b-benzyl-7-hydroxy-6,7,8,8a,9,10-hexahydro-5H-phenanthrene-2-carboxylate (PubChem CID 163739206) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl (4bS,8aR)-4b-benzyl-7-hydroxy-6,7,8,8a,9,10-hexahydro-5H-phenanthrene-2-carboxylate.
| Compound Name | methyl (4bS,8aR)-4b-benzyl-7-hydroxy-6,7,8,8a,9,10-hexahydro-5H-phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 163739206 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | methyl (4bS,8aR)-4b-benzyl-7-hydroxy-6,7,8,8a,9,10-hexahydro-5H-phenanthrene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC[C@@H]1CC(O)CC[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C23H26O3/c1-26-22(25)18-8-10-21-17(13-18)7-9-19-14-20(24)11-12-23(19,21)15-16-5-3-2-4-6-16/h2-6,8,10,13,19-20,24H,7,9,11-12,14-15H2,1H3/t19-,20?,23+/m1/s1 |
| InChIKey | LGHIDLQDRQOLAV-HUJVSABWSA-N |
| XLogP | 4.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |