C33H43N3O2 — CID 68581267
(4bS,7R,8aR)-4b-benzyl-7-hydroxy-N-[3-(4-methylpiperazin-1-yl)propyl]-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide (PubChem CID 68581267) has the molecular formula C33H43N3O2 and a molecular weight of 513.73 g/mol. Its IUPAC name is (4bS,7R,8aR)-4b-benzyl-7-hydroxy-N-[3-(4-methylpiperazin-1-yl)propyl]-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide.
| Compound Name | (4bS,7R,8aR)-4b-benzyl-7-hydroxy-N-[3-(4-methylpiperazin-1-yl)propyl]-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide |
|---|---|
| PubChem CID | 68581267 |
| Molecular Formula | C33H43N3O2 |
| Molecular Weight | 513.73 g/mol |
| Exact Mass | 513.34 |
| IUPAC Name | (4bS,7R,8aR)-4b-benzyl-7-hydroxy-N-[3-(4-methylpiperazin-1-yl)propyl]-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthrene-2-carboxamide |
| SMILES | CC#C[C@@]1(O)CC[C@@]2(Cc3ccccc3)c3ccc(C(=O)NCCCN4CCN(C)CC4)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C33H43N3O2/c1-3-14-32(38)15-16-33(24-26-8-5-4-6-9-26)29(25-32)12-10-27-23-28(11-13-30(27)33)31(37)34-17-7-18-36-21-19-35(2)20-22-36/h4-6,8-9,11,13,23,29,38H,7,10,12,15-22,24-25H2,1-2H3,(H,34,37)/t29-,32-,33+/m1/s1 |
| InChIKey | MZXVZSNAEBBXDD-FNTXHVAFSA-N |
| XLogP | 4.04 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.73 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|