C35H33NO3 — CID 159612779
(2R,4aR,10aR)-4a-benzyl-2-hydroxy-7-[2-(2-methyl-3-pyridinyl)acetyl]-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthren-3-one (PubChem CID 159612779) has the molecular formula C35H33NO3 and a molecular weight of 515.65 g/mol. Its IUPAC name is (2R,4aR,10aR)-4a-benzyl-2-hydroxy-7-[2-(2-methyl-3-pyridinyl)acetyl]-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthren-3-one.
| Compound Name | (2R,4aR,10aR)-4a-benzyl-2-hydroxy-7-[2-(2-methyl-3-pyridinyl)acetyl]-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthren-3-one |
|---|---|
| PubChem CID | 159612779 |
| Molecular Formula | C35H33NO3 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | (2R,4aR,10aR)-4a-benzyl-2-hydroxy-7-[2-(2-methyl-3-pyridinyl)acetyl]-2-phenyl-4,9,10,10a-tetrahydro-1H-phenanthren-3-one |
| SMILES | Cc1ncccc1CC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](O)(c3ccccc3)C(=O)C[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C35H33NO3/c1-24-26(11-8-18-36-24)20-32(37)28-15-17-31-27(19-28)14-16-30-22-35(39,29-12-6-3-7-13-29)33(38)23-34(30,31)21-25-9-4-2-5-10-25/h2-13,15,17-19,30,39H,14,16,20-23H2,1H3/t30-,34-,35-/m1/s1 |
| InChIKey | MMXIGSLTIPTNTL-KVFIQDKASA-N |
| XLogP | 6.11 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |