C32H35NO2 — CID 68581981
(2R,4aS,10aR)-4a-benzyl-2-but-1-ynyl-7-[(2-methyl-3-pyridinyl)methoxy]-1,3,4,9,10,10a-hexahydrophenanthren-2-ol (PubChem CID 68581981) has the molecular formula C32H35NO2 and a molecular weight of 465.64 g/mol. Its IUPAC name is (2R,4aS,10aR)-4a-benzyl-2-but-1-ynyl-7-[(2-methyl-3-pyridinyl)methoxy]-1,3,4,9,10,10a-hexahydrophenanthren-2-ol.
| Compound Name | (2R,4aS,10aR)-4a-benzyl-2-but-1-ynyl-7-[(2-methyl-3-pyridinyl)methoxy]-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 68581981 |
| Molecular Formula | C32H35NO2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | (2R,4aS,10aR)-4a-benzyl-2-but-1-ynyl-7-[(2-methyl-3-pyridinyl)methoxy]-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
| SMILES | CCC#C[C@@]1(O)CC[C@@]2(Cc3ccccc3)c3ccc(OCc4cccnc4C)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C32H35NO2/c1-3-4-16-31(34)17-18-32(21-25-9-6-5-7-10-25)28(22-31)13-12-26-20-29(14-15-30(26)32)35-23-27-11-8-19-33-24(27)2/h5-11,14-15,19-20,28,34H,3,12-13,17-18,21-23H2,1-2H3/t28-,31-,32+/m1/s1 |
| InChIKey | CEXJUNJSZITGMF-ADVLSPMASA-N |
| XLogP | 6.34 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|