C30H31NO2 — CID 68580882
(2R,4aS,10aR)-4a-benzyl-2-prop-1-ynyl-7-(pyridin-2-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol (PubChem CID 68580882) has the molecular formula C30H31NO2 and a molecular weight of 437.58 g/mol. Its IUPAC name is (2R,4aS,10aR)-4a-benzyl-2-prop-1-ynyl-7-(pyridin-2-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol.
| Compound Name | (2R,4aS,10aR)-4a-benzyl-2-prop-1-ynyl-7-(pyridin-2-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 68580882 |
| Molecular Formula | C30H31NO2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (2R,4aS,10aR)-4a-benzyl-2-prop-1-ynyl-7-(pyridin-2-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
| SMILES | CC#C[C@@]1(O)CC[C@@]2(Cc3ccccc3)c3ccc(OCc4ccccn4)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C30H31NO2/c1-2-15-29(32)16-17-30(20-23-8-4-3-5-9-23)25(21-29)12-11-24-19-27(13-14-28(24)30)33-22-26-10-6-7-18-31-26/h3-10,13-14,18-19,25,32H,11-12,16-17,20-22H2,1H3/t25-,29-,30+/m1/s1 |
| InChIKey | YSYXUCIMSRBZLL-RKJPZGCHSA-N |
| XLogP | 5.64 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|