C31H37NO2 — CID 68580775
(2R,4aS,10aR)-4a-benzyl-7-[(2-methyl-4-pyridinyl)methoxy]-2-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol (PubChem CID 68580775) has the molecular formula C31H37NO2 and a molecular weight of 455.64 g/mol. Its IUPAC name is (2R,4aS,10aR)-4a-benzyl-7-[(2-methyl-4-pyridinyl)methoxy]-2-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol.
| Compound Name | (2R,4aS,10aR)-4a-benzyl-7-[(2-methyl-4-pyridinyl)methoxy]-2-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 68580775 |
| Molecular Formula | C31H37NO2 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | (2R,4aS,10aR)-4a-benzyl-7-[(2-methyl-4-pyridinyl)methoxy]-2-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
| SMILES | CCC[C@@]1(O)CC[C@@]2(Cc3ccccc3)c3ccc(OCc4ccnc(C)c4)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C31H37NO2/c1-3-14-30(33)15-16-31(20-24-7-5-4-6-8-24)27(21-30)10-9-26-19-28(11-12-29(26)31)34-22-25-13-17-32-23(2)18-25/h4-8,11-13,17-19,27,33H,3,9-10,14-16,20-22H2,1-2H3/t27-,30-,31+/m1/s1 |
| InChIKey | YIPKONPGUOWXIH-UPHHSBJESA-N |
| XLogP | 6.73 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |