C30H34N2O4 — CID 68580740
6-[[(4bS,7R,8aR)-4b-benzyl-7-(ethoxymethyl)-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]oxy]pyridine-3-carboxamide (PubChem CID 68580740) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is 6-[[(4bS,7R,8aR)-4b-benzyl-7-(ethoxymethyl)-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]oxy]pyridine-3-carboxamide.
| Compound Name | 6-[[(4bS,7R,8aR)-4b-benzyl-7-(ethoxymethyl)-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]oxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68580740 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 6-[[(4bS,7R,8aR)-4b-benzyl-7-(ethoxymethyl)-7-hydroxy-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]oxy]pyridine-3-carboxamide |
| SMILES | CCOC[C@@]1(O)CC[C@@]2(Cc3ccccc3)c3ccc(Oc4ccc(C(N)=O)cn4)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C30H34N2O4/c1-2-35-20-29(34)14-15-30(17-21-6-4-3-5-7-21)24(18-29)10-8-22-16-25(11-12-26(22)30)36-27-13-9-23(19-32-27)28(31)33/h3-7,9,11-13,16,19,24,34H,2,8,10,14-15,17-18,20H2,1H3,(H2,31,33)/t24-,29-,30+/m1/s1 |
| InChIKey | GSOWTGJKBYVXNX-DQWNXYKBSA-N |
| XLogP | 4.97 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |