C24H25N3O2 — CID 66673399
6-[[2-(3-phenylpropylamino)-2,3-dihydro-1H-inden-5-yl]oxy]pyridine-3-carboxamide (PubChem CID 66673399) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 6-[[2-(3-phenylpropylamino)-2,3-dihydro-1H-inden-5-yl]oxy]pyridine-3-carboxamide.
| Compound Name | 6-[[2-(3-phenylpropylamino)-2,3-dihydro-1H-inden-5-yl]oxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66673399 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 6-[[2-(3-phenylpropylamino)-2,3-dihydro-1H-inden-5-yl]oxy]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(Oc2ccc3c(c2)CC(NCCCc2ccccc2)C3)nc1 |
| InChI | InChI=1S/C24H25N3O2/c25-24(28)19-9-11-23(27-16-19)29-22-10-8-18-13-21(14-20(18)15-22)26-12-4-7-17-5-2-1-3-6-17/h1-3,5-6,8-11,15-16,21,26H,4,7,12-14H2,(H2,25,28) |
| InChIKey | GDPLEAONMHQCMW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|