C20H25N3O3 — CID 59730239
6-[4-[2-[(4-hydroxycyclohexyl)amino]ethyl]phenoxy]pyridine-3-carboxamide (PubChem CID 59730239) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 6-[4-[2-[(4-hydroxycyclohexyl)amino]ethyl]phenoxy]pyridine-3-carboxamide.
| Compound Name | 6-[4-[2-[(4-hydroxycyclohexyl)amino]ethyl]phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59730239 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 6-[4-[2-[(4-hydroxycyclohexyl)amino]ethyl]phenoxy]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(CCNC3CCC(O)CC3)cc2)nc1 |
| InChI | InChI=1S/C20H25N3O3/c21-20(25)15-3-10-19(23-13-15)26-18-8-1-14(2-9-18)11-12-22-16-4-6-17(24)7-5-16/h1-3,8-10,13,16-17,22,24H,4-7,11-12H2,(H2,21,25) |
| InChIKey | OYKGGIGNKWVPJE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |