C26H39N3O3Si — CID 68748955
6-[4-[2-[[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]amino]ethyl]phenoxy]pyridine-3-carboxamide (PubChem CID 68748955) has the molecular formula C26H39N3O3Si and a molecular weight of 469.70 g/mol. Its IUPAC name is 6-[4-[2-[[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]amino]ethyl]phenoxy]pyridine-3-carboxamide.
| Compound Name | 6-[4-[2-[[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]amino]ethyl]phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68748955 |
| Molecular Formula | C26H39N3O3Si |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 6-[4-[2-[[(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxycyclohexyl]amino]ethyl]phenoxy]pyridine-3-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@H](NCCc2ccc(Oc3ccc(C(N)=O)cn3)cc2)C1 |
| InChI | InChI=1S/C26H39N3O3Si/c1-26(2,3)33(4,5)32-23-8-6-7-21(17-23)28-16-15-19-9-12-22(13-10-19)31-24-14-11-20(18-29-24)25(27)30/h9-14,18,21,23,28H,6-8,15-17H2,1-5H3,(H2,27,30)/t21-,23-/m0/s1 |
| InChIKey | FTNRQBULPVTXKG-GMAHTHKFSA-N |
| XLogP | 5.44 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|