C30H42N2O2 — CID 68580823
(4aS,10aR)-4a-[[3-[(1-methylpiperidin-4-yl)amino]phenyl]methyl]-2-propyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol (PubChem CID 68580823) has the molecular formula C30H42N2O2 and a molecular weight of 462.68 g/mol. Its IUPAC name is (4aS,10aR)-4a-[[3-[(1-methylpiperidin-4-yl)amino]phenyl]methyl]-2-propyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol.
| Compound Name | (4aS,10aR)-4a-[[3-[(1-methylpiperidin-4-yl)amino]phenyl]methyl]-2-propyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol |
|---|---|
| PubChem CID | 68580823 |
| Molecular Formula | C30H42N2O2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | (4aS,10aR)-4a-[[3-[(1-methylpiperidin-4-yl)amino]phenyl]methyl]-2-propyl-1,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol |
| SMILES | CCCC1(O)CC[C@@]2(Cc3cccc(NC4CCN(C)CC4)c3)c3ccc(O)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C30H42N2O2/c1-3-13-29(34)14-15-30(24(21-29)8-7-23-19-27(33)9-10-28(23)30)20-22-5-4-6-26(18-22)31-25-11-16-32(2)17-12-25/h4-6,9-10,18-19,24-25,31,33-34H,3,7-8,11-17,20-21H2,1-2H3/t24-,29?,30+/m1/s1 |
| InChIKey | OUSGGYVQUIKQNL-JWGFOWBUSA-N |
| XLogP | 5.66 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |