C30H40O2 — CID 68580530
(2R,4aS,10aR)-4a-benzyl-7-hex-5-enoxy-2-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol (PubChem CID 68580530) has the molecular formula C30H40O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is (2R,4aS,10aR)-4a-benzyl-7-hex-5-enoxy-2-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol.
| Compound Name | (2R,4aS,10aR)-4a-benzyl-7-hex-5-enoxy-2-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 68580530 |
| Molecular Formula | C30H40O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | (2R,4aS,10aR)-4a-benzyl-7-hex-5-enoxy-2-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
| SMILES | C=CCCCCOc1ccc2c(c1)CC[C@@H]1C[C@@](O)(CCC)CC[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C30H40O2/c1-3-5-6-10-20-32-27-15-16-28-25(21-27)13-14-26-23-29(31,17-4-2)18-19-30(26,28)22-24-11-8-7-9-12-24/h3,7-9,11-12,15-16,21,26,31H,1,4-6,10,13-14,17-20,22-23H2,2H3/t26-,29-,30+/m1/s1 |
| InChIKey | GGFUQHDSQYRWTF-XUEBXJBISA-N |
| XLogP | 7.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|