C34H35NO3 — CID 68580770
(2R,4aS,10aR)-4a-benzyl-2-(phenoxymethyl)-7-(pyridin-3-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol (PubChem CID 68580770) has the molecular formula C34H35NO3 and a molecular weight of 505.66 g/mol. Its IUPAC name is (2R,4aS,10aR)-4a-benzyl-2-(phenoxymethyl)-7-(pyridin-3-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol.
| Compound Name | (2R,4aS,10aR)-4a-benzyl-2-(phenoxymethyl)-7-(pyridin-3-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 68580770 |
| Molecular Formula | C34H35NO3 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | (2R,4aS,10aR)-4a-benzyl-2-(phenoxymethyl)-7-(pyridin-3-ylmethoxy)-1,3,4,9,10,10a-hexahydrophenanthren-2-ol |
| SMILES | O[C@]1(COc2ccccc2)CC[C@@]2(Cc3ccccc3)c3ccc(OCc4cccnc4)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C34H35NO3/c36-33(25-38-30-11-5-2-6-12-30)17-18-34(21-26-8-3-1-4-9-26)29(22-33)14-13-28-20-31(15-16-32(28)34)37-24-27-10-7-19-35-23-27/h1-12,15-16,19-20,23,29,36H,13-14,17-18,21-22,24-25H2/t29-,33-,34+/m1/s1 |
| InChIKey | RPTWQRLMWSXJOW-SJZCYFJVSA-N |
| XLogP | 6.70 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |