C27H32N2O3 — CID 68581932
[(4bS,8aR)-4b-[[3-(dimethylamino)phenyl]methyl]-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] carbamate (PubChem CID 68581932) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is [(4bS,8aR)-4b-[[3-(dimethylamino)phenyl]methyl]-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] carbamate.
| Compound Name | [(4bS,8aR)-4b-[[3-(dimethylamino)phenyl]methyl]-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] carbamate |
|---|---|
| PubChem CID | 68581932 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | [(4bS,8aR)-4b-[[3-(dimethylamino)phenyl]methyl]-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] carbamate |
| SMILES | CC#CC1(O)CC[C@@]2(Cc3cccc(N(C)C)c3)c3ccc(OC(N)=O)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C27H32N2O3/c1-4-12-26(31)13-14-27(17-19-6-5-7-22(15-19)29(2)3)21(18-26)9-8-20-16-23(32-25(28)30)10-11-24(20)27/h5-7,10-11,15-16,21,31H,8-9,13-14,17-18H2,1-3H3,(H2,28,30)/t21-,26?,27+/m1/s1 |
| InChIKey | HMMWYEHFVQKYMQ-KWKDFTITSA-N |
| XLogP | 4.19 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|