C26H38N2O3 — CID 10224345
[(4bR,7R,8aR)-4b-ethyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N-[3-(dimethylamino)propyl]-N-methylcarbamate (PubChem CID 10224345) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is [(4bR,7R,8aR)-4b-ethyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N-[3-(dimethylamino)propyl]-N-methylcarbamate.
| Compound Name | [(4bR,7R,8aR)-4b-ethyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N-[3-(dimethylamino)propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 10224345 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | [(4bR,7R,8aR)-4b-ethyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N-[3-(dimethylamino)propyl]-N-methylcarbamate |
| SMILES | CC#C[C@@]1(O)CC[C@@]2(CC)c3ccc(OC(=O)N(C)CCCN(C)C)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C26H38N2O3/c1-6-13-25(30)14-15-26(7-2)21(19-25)10-9-20-18-22(11-12-23(20)26)31-24(29)28(5)17-8-16-27(3)4/h11-12,18,21,30H,7-10,14-17,19H2,1-5H3/t21-,25-,26-/m1/s1 |
| InChIKey | GABPJBNZYTYCLP-LPPUWEFUSA-N |
| XLogP | 4.22 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|