C23H30ClNO4 — CID 69433296
[(4bR,7S,8aS)-7-(2-chloroethynyl)-7-methoxy-4b-(2-methoxyethyl)-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N,N-dimethylcarbamate (PubChem CID 69433296) has the molecular formula C23H30ClNO4 and a molecular weight of 419.95 g/mol. Its IUPAC name is [(4bR,7S,8aS)-7-(2-chloroethynyl)-7-methoxy-4b-(2-methoxyethyl)-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(4bR,7S,8aS)-7-(2-chloroethynyl)-7-methoxy-4b-(2-methoxyethyl)-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 69433296 |
| Molecular Formula | C23H30ClNO4 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | [(4bR,7S,8aS)-7-(2-chloroethynyl)-7-methoxy-4b-(2-methoxyethyl)-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] N,N-dimethylcarbamate |
| SMILES | COCC[C@]12CC[C@](C#CCl)(OC)C[C@@H]1CCc1cc(OC(=O)N(C)C)ccc12 |
| InChI | InChI=1S/C23H30ClNO4/c1-25(2)21(26)29-19-7-8-20-17(15-19)5-6-18-16-22(28-4,11-13-24)9-10-23(18,20)12-14-27-3/h7-8,15,18H,5-6,9-10,12,14,16H2,1-4H3/t18-,22+,23+/m0/s1 |
| InChIKey | LVAAGCYRPRMUJB-CDNPAEQRSA-N |
| XLogP | 4.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|