C29H35NO3 — CID 68583969
tert-butyl N-[(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]carbamate (PubChem CID 68583969) has the molecular formula C29H35NO3 and a molecular weight of 445.60 g/mol. Its IUPAC name is tert-butyl N-[(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]carbamate |
|---|---|
| PubChem CID | 68583969 |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | tert-butyl N-[(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]carbamate |
| SMILES | CC#C[C@@]1(O)CC[C@@]2(Cc3ccccc3)c3ccc(NC(=O)OC(C)(C)C)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C29H35NO3/c1-5-15-28(32)16-17-29(19-21-9-7-6-8-10-21)23(20-28)12-11-22-18-24(13-14-25(22)29)30-26(31)33-27(2,3)4/h6-10,13-14,18,23,32H,11-12,16-17,19-20H2,1-4H3,(H,30,31)/t23-,28-,29+/m1/s1 |
| InChIKey | NUOPCXDPVUNZKC-ZPJFYFFZSA-N |
| XLogP | 6.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|