C26H27ClN2O3 — CID 68582818
(E)-4-[(2S,4aR,10aS)-2-(2-chloroethynyl)-2,7-dihydroxy-1,3,4,9,10,10a-hexahydrophenanthren-4a-yl]-N-(pyridin-2-ylmethyl)but-2-enamide (PubChem CID 68582818) has the molecular formula C26H27ClN2O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is (E)-4-[(2S,4aR,10aS)-2-(2-chloroethynyl)-2,7-dihydroxy-1,3,4,9,10,10a-hexahydrophenanthren-4a-yl]-N-(pyridin-2-ylmethyl)but-2-enamide.
| Compound Name | (E)-4-[(2S,4aR,10aS)-2-(2-chloroethynyl)-2,7-dihydroxy-1,3,4,9,10,10a-hexahydrophenanthren-4a-yl]-N-(pyridin-2-ylmethyl)but-2-enamide |
|---|---|
| PubChem CID | 68582818 |
| Molecular Formula | C26H27ClN2O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (E)-4-[(2S,4aR,10aS)-2-(2-chloroethynyl)-2,7-dihydroxy-1,3,4,9,10,10a-hexahydrophenanthren-4a-yl]-N-(pyridin-2-ylmethyl)but-2-enamide |
| SMILES | O=C(/C=C/C[C@]12CC[C@@](O)(C#CCl)C[C@@H]1CCc1cc(O)ccc12)NCc1ccccn1 |
| InChI | InChI=1S/C26H27ClN2O3/c27-14-13-25(32)11-12-26(10-3-5-24(31)29-18-21-4-1-2-15-28-21)20(17-25)7-6-19-16-22(30)8-9-23(19)26/h1-5,8-9,15-16,20,30,32H,6-7,10-12,17-18H2,(H,29,31)/b5-3+/t20-,25+,26-/m0/s1 |
| InChIKey | HQDMNWQWYCASDI-UUQFIHINSA-N |
| XLogP | 3.96 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|