C16H16ClN3O — CID 94594424
1-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-3-(pyridin-2-ylmethyl)urea (PubChem CID 94594424) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 1-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-3-(pyridin-2-ylmethyl)urea.
| Compound Name | 1-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-3-(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 94594424 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]-3-(pyridin-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccccn1)N[C@H]1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H16ClN3O/c17-12-5-6-14-11(9-12)4-7-15(14)20-16(21)19-10-13-3-1-2-8-18-13/h1-3,5-6,8-9,15H,4,7,10H2,(H2,19,20,21)/t15-/m0/s1 |
| InChIKey | UGHBELWBFPVUOP-HNNXBMFYSA-N |
| XLogP | 3.22 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |