About 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea
1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 86966975) has the molecular formula C20H19ClN4O
and a molecular weight of 366.85 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea.
Molecular Properties
| Compound Name | 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea |
| PubChem CID | 86966975 |
| Molecular Formula | C20H19ClN4O |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | O=C(NCc1cccc(-n2cccn2)c1)NC1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H19ClN4O/c21-16-6-7-18-15(12-16)5-8-19(18)24-20(26)22-13-14-3-1-4-17(11-14)25-10-2-9-23-25/h1-4,6-7,9-12,19H,5,8,13H2,(H2,22,24,26) |
| InChIKey | LORCIHMPAWQQMV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea?
The IUPAC name of 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea (CID 86966975) is 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea.
What is the SMILES notation for 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea?
The canonical SMILES for 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea is O=C(NCc1cccc(-n2cccn2)c1)NC1CCc2cc(Cl)ccc21.
What is the InChIKey of 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea?
The InChIKey is LORCIHMPAWQQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN4O/c21-16-6-7-18-15(12-16)5-8-19(18)24-20(26)22-13-14-3-1-4-17(11-14)25-10-2-9-23-25/h1-4,6-7,9-12,19H,5,8,13H2,(H2,22,24,26).
What are the key properties of 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea?
1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea has a molecular weight of 366.85 g/mol, XLogP of 4.01, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[(3-pyrazol-1-ylphenyl)methyl]urea is sourced from PubChem (CID 86966975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).