C18H14F3N3O — CID 29183806
N-[(3-pyrazol-1-ylphenyl)methyl]-2-(2,3,6-trifluorophenyl)acetamide (PubChem CID 29183806) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is N-[(3-pyrazol-1-ylphenyl)methyl]-2-(2,3,6-trifluorophenyl)acetamide.
| Compound Name | N-[(3-pyrazol-1-ylphenyl)methyl]-2-(2,3,6-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 29183806 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[(3-pyrazol-1-ylphenyl)methyl]-2-(2,3,6-trifluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)ccc(F)c1F)NCc1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C18H14F3N3O/c19-15-5-6-16(20)18(21)14(15)10-17(25)22-11-12-3-1-4-13(9-12)24-8-2-7-23-24/h1-9H,10-11H2,(H,22,25) |
| InChIKey | MSKKGVMCPRTLPK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|