C17H15BrFN5O — CID 86967357
1-(2-bromo-4-fluoroanilino)-3-[(3-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 86967357) has the molecular formula C17H15BrFN5O and a molecular weight of 404.24 g/mol. Its IUPAC name is 1-(2-bromo-4-fluoroanilino)-3-[(3-pyrazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-(2-bromo-4-fluoroanilino)-3-[(3-pyrazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 86967357 |
| Molecular Formula | C17H15BrFN5O |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 1-(2-bromo-4-fluoroanilino)-3-[(3-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | O=C(NCc1cccc(-n2cccn2)c1)NNc1ccc(F)cc1Br |
| InChI | InChI=1S/C17H15BrFN5O/c18-15-10-13(19)5-6-16(15)22-23-17(25)20-11-12-3-1-4-14(9-12)24-8-2-7-21-24/h1-10,22H,11H2,(H2,20,23,25) |
| InChIKey | GIDKLRGCNGEBRV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|