C15H23Cl2N2O3+ — CID 7404058
(5R)-2,5-dichloro-4,4-dimethoxy-3-(4-methylpiperazin-4-ium-1-yl)-5-prop-2-enylcyclopent-2-en-1-one (PubChem CID 7404058) has the molecular formula C15H23Cl2N2O3+ and a molecular weight of 350.27 g/mol. Its IUPAC name is (5R)-2,5-dichloro-4,4-dimethoxy-3-(4-methylpiperazin-4-ium-1-yl)-5-prop-2-enylcyclopent-2-en-1-one.
| Compound Name | (5R)-2,5-dichloro-4,4-dimethoxy-3-(4-methylpiperazin-4-ium-1-yl)-5-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 7404058 |
| Molecular Formula | C15H23Cl2N2O3+ |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (5R)-2,5-dichloro-4,4-dimethoxy-3-(4-methylpiperazin-4-ium-1-yl)-5-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CC[C@@]1(Cl)C(=O)C(Cl)=C(N2CC[NH+](C)CC2)C1(OC)OC |
| InChI | InChI=1S/C15H22Cl2N2O3/c1-5-6-14(17)13(20)11(16)12(15(14,21-3)22-4)19-9-7-18(2)8-10-19/h5H,1,6-10H2,2-4H3/p+1/t14-/m1/s1 |
| InChIKey | MTAQOUFKTSAFTA-CQSZACIVSA-O |
| XLogP | 0.39 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|